051977hn 051977hn

12-02-2019
Mathematics

contestada

Hall adds 50% of the entire 3-liter oil bottle to a bowl. How much oil did he use

Respuesta :

xavierdz9 xavierdz9

12-02-2019

Answer:

1.5 liters

Step-by-step explanation:

3 times 0.5=1.5

Answer Link

Otras preguntas

NO LINKS!!! Complete the tables of ratios for similar polygons

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

URGENT! (Please give the correct answers!)Complete the table of input and output numbers for the function, y=4x-3.(Show your working).

A half litre bottle has a mass of 80g.If contains 500cm3 of liquid when full.The bottle is filled with olive oil of density =0.90g/cm3a. Calculate the mass of o

Compute the value of 1-2+3-4+5…+2019-2020+2021. Thanks

three-part question that follows, provide your answer to each part in the given workspace. Identify each part with a coordinating response. Be s Use the figure

Aluminum reacts with chlorine gas to form aluminum chloride via the following reaction: 2Al(s) + 3Cl₂ (g)→2AlCl3 (s) You are given 31.0 g of aluminum and 36.0 g

what type of language can Africans speak

show that 2x +1 is a factor of 2x3 +5x2+4x+1 and factories completely

Which inference is best supported by the passage? O Dr. Lanyon expects to recover from his illness. O Dr. Lanyon has learned damaging new information about Dr.