zqz4fuj3ap zqz4fuj3ap

11-02-2021
Mathematics

contestada

What is the solution to the equation x+2--Ex-5?

X=-8
X=-7
O
x=7
0
X=8

^^ picture

What is the solution to the equation x2Ex5 X8 X7 O x7 0 X8 picture class=

Respuesta :

Zaner125 Zaner125

11-02-2021

The answer to the equation is X = 7

Answer Link

Otras preguntas

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2

How much is 3 quaters + three dimes + 5 cents equals?I'm trying to make a dollar

21. Water that is sprayed upward from a sprinkler with an initial velocity of 20 m/s can be approximated by the function y=-5x² + 20x, where y is the height of

“How does Shakespeare convey the complexities of jealousy in Othello?”

You have Birr 1,500 to invest today at 7% interest compounded annually.Find how much you will have accumulated in the account at the end of (1) 3 years, (2) 6 y

Solve (v + 2)² − 24 = 0 where v is a real number.

Historical revisionism is the reinterpretation of historical events based on new perspective and knowledge, changing the accepted understanding of historical id

Suppose that 48% of people own dogs. If you pick two people at random, what is the probability that they both own a dog?

Lyft strives to earn a profit by improving people's lives through the world's best transportation. This represents its mission. True False

Which word would you find on a dictionary page with the following guide words?