kalirodriguez62 kalirodriguez62

11-03-2017
English

contestada

What does the author mean when she says that chuck berry was know for his phrasing?

Respuesta :

annabelle8 annabelle8

12-03-2017

I'm pretty sure it means that he was known for the way he talks and his sentence structure???

Answer Link

Otras preguntas

16 / 4 * (3 - 1) a) 2 b) 4 c) 8

Perform the operation. 3/a^2b + 2/ab^2

isabella and aiden get a reward of $119 in the ratio of 4 3, what fraction of the total reward does isabella get

log 9-log 4÷log 3-log 2

1) the coordination of the human immune system is known as _______?

Christina wants to buy some miniature goldfish. She reads that a 9-gallon aquarium is the right size for 3 miniature goldfish. The graph represents this relatio

how to balance this equation NH4OH+H3PO4=(NH4)3PO4+H2O with explainatio please

Noam Chomsky introduced the term _________________ to describe a theoretical structure that prewire infants and children to learn the language of our culture.

isabella and aiden get a reward of $119 in the ratio of 4 3, what fraction of the total reward does isabella get

Which sentence from their eyes were watching god contains an example of dialect? she felt honored by janie’s acquaintance . . . her nose was slightly pointed an