wertyong6292 wertyong6292

11-10-2017
Biology

contestada

Evolution can only take place by the forces of natural selection.
a. True
b. False

Respuesta :

kimberlyhinders kimberlyhinders

11-10-2017

i believe it is B. False.

Answer Link

Otras preguntas

The vapor pressure of water at 25 •C is 23.8 mmHg. Write K for the vaporization of water in the unit of atm. What is Kc for the vaporization process? answer is

ow did rationing help win the war'?

A group of students measured the time taken between seeing and hearing another student clashing two pieces of wood together. The distance from the source of sou

Let x2+13x=−3 . What values make an equivalent number sentence after completing the square? Enter your answers in the boxes. x2+13x+ =

Describe what is happening in steps A-C of the diagram above.

This nation has tossed its cap over the wall of space and we have no choice but to follow it. Is this statement a valid argument or a logical fallacy ? Use deta

When a certain constant force acts upon an object with mass 22 kg, the acceleration of the object is 3 /ms2. If the same force acts upon another object whose ma

Martin is against which of the following?

divide 240£ in the ratio 3:5:12

What is the maximum number of grams of copper that could be produced by the reaction of 30.0 of copper oxide with excess methane? CuO(s)+CH4(I)-H2O(I)+Cu(s)+CO2